C19H31N3 — CID 18654010
(4S,6R)-N-[1-(4-tert-butylphenyl)propan-2-yl]-4,6-dimethyl-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 18654010) has the molecular formula C19H31N3 and a molecular weight of 301.48 g/mol. Its IUPAC name is (4S,6R)-N-[1-(4-tert-butylphenyl)propan-2-yl]-4,6-dimethyl-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | (4S,6R)-N-[1-(4-tert-butylphenyl)propan-2-yl]-4,6-dimethyl-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 18654010 |
| Molecular Formula | C19H31N3 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.25 |
| IUPAC Name | (4S,6R)-N-[1-(4-tert-butylphenyl)propan-2-yl]-4,6-dimethyl-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | CC(Cc1ccc(C(C)(C)C)cc1)NC1=N[C@@H](C)C[C@@H](C)N1 |
| InChI | InChI=1S/C19H31N3/c1-13-11-14(2)21-18(20-13)22-15(3)12-16-7-9-17(10-8-16)19(4,5)6/h7-10,13-15H,11-12H2,1-6H3,(H2,20,21,22)/t13-,14+,15? |
| InChIKey | CAKFEIDSXFAHRX-YIONKMFJSA-N |
| XLogP | 3.63 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |