C14H30O5Si — CID 18654075
(2R,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,4-trimethoxypentanal (PubChem CID 18654075) has the molecular formula C14H30O5Si and a molecular weight of 306.48 g/mol. Its IUPAC name is (2R,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,4-trimethoxypentanal.
| Compound Name | (2R,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,4-trimethoxypentanal |
|---|---|
| PubChem CID | 18654075 |
| Molecular Formula | C14H30O5Si |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (2R,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,4-trimethoxypentanal |
| SMILES | CO[C@H]([C@H](C=O)OC)[C@@H](CO[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C14H30O5Si/c1-14(2,3)20(7,8)19-10-12(17-5)13(18-6)11(9-15)16-4/h9,11-13H,10H2,1-8H3/t11-,12+,13+/m0/s1 |
| InChIKey | QBBSEQWNRJQKSH-YNEHKIRRSA-N |
| XLogP | 2.25 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|