C29H40O5Si — CID 18654084
(2S)-2-[(4R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-2-oxo-1,3-dioxolan-4-yl]octanal (PubChem CID 18654084) has the molecular formula C29H40O5Si and a molecular weight of 496.72 g/mol. Its IUPAC name is (2S)-2-[(4R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-2-oxo-1,3-dioxolan-4-yl]octanal.
| Compound Name | (2S)-2-[(4R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-2-oxo-1,3-dioxolan-4-yl]octanal |
|---|---|
| PubChem CID | 18654084 |
| Molecular Formula | C29H40O5Si |
| Molecular Weight | 496.72 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | (2S)-2-[(4R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-2-oxo-1,3-dioxolan-4-yl]octanal |
| SMILES | CCCCCC[C@H](C=O)[C@H]1OC(=O)OC1(C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H40O5Si/c1-6-7-8-11-16-23(21-30)26-29(5,34-27(31)33-26)22-32-35(28(2,3)4,24-17-12-9-13-18-24)25-19-14-10-15-20-25/h9-10,12-15,17-21,23,26H,6-8,11,16,22H2,1-5H3/t23-,26-,29?/m1/s1 |
| InChIKey | HTBSGQSNGFDJCL-XATCSJPRSA-N |
| XLogP | 5.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.72 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|