C12H22O11 — CID 18654347
(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexan-1-one (PubChem CID 18654347) has the molecular formula C12H22O11 and a molecular weight of 342.30 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexan-1-one.
| Compound Name | (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexan-1-one |
|---|---|
| PubChem CID | 18654347 |
| Molecular Formula | C12H22O11 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexan-1-one |
| SMILES | O=C(C1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H22O11/c13-1-3(15)5(16)7(18)9(20)11(22)12-10(21)8(19)6(17)4(2-14)23-12/h3-10,12-21H,1-2H2/t3-,4-,5-,6+,7+,8+,9+,10-,12?/m1/s1 |
| InChIKey | VZQZXAJWZUSYHU-WXZLILOSSA-N |
| XLogP | -6.17 |
| TPSA | 208.37 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | -6.17 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |