C15H20ClN3O4 — CID 18655126
(2S)-2-amino-3-methyl-N-[1-(5-nitro-1-benzofuran-2-yl)ethyl]butanamide;hydrochloride (PubChem CID 18655126) has the molecular formula C15H20ClN3O4 and a molecular weight of 341.80 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-N-[1-(5-nitro-1-benzofuran-2-yl)ethyl]butanamide;hydrochloride.
| Compound Name | (2S)-2-amino-3-methyl-N-[1-(5-nitro-1-benzofuran-2-yl)ethyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 18655126 |
| Molecular Formula | C15H20ClN3O4 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | (2S)-2-amino-3-methyl-N-[1-(5-nitro-1-benzofuran-2-yl)ethyl]butanamide;hydrochloride |
| SMILES | CC(NC(=O)[C@@H](N)C(C)C)c1cc2cc([N+](=O)[O-])ccc2o1.Cl |
| InChI | InChI=1S/C15H19N3O4.ClH/c1-8(2)14(16)15(19)17-9(3)13-7-10-6-11(18(20)21)4-5-12(10)22-13;/h4-9,14H,16H2,1-3H3,(H,17,19);1H/t9?,14-;/m0./s1 |
| InChIKey | DMXQAWWSMWELJD-PUVHTRCLSA-N |
| XLogP | 2.92 |
| TPSA | 111.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|