C44H51F3N6O8 — CID 18655548
[(2S,3S,5S)-2,5-bis[[(2S)-3-methyl-2-(pyridin-2-ylmethoxycarbonylamino)butanoyl]amino]-1,6-diphenylhexan-3-yl] 2,2,2-trifluoroacetate (PubChem CID 18655548) has the molecular formula C44H51F3N6O8 and a molecular weight of 848.92 g/mol. Its IUPAC name is [(2S,3S,5S)-2,5-bis[[(2S)-3-methyl-2-(pyridin-2-ylmethoxycarbonylamino)butanoyl]amino]-1,6-diphenylhexan-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2S,3S,5S)-2,5-bis[[(2S)-3-methyl-2-(pyridin-2-ylmethoxycarbonylamino)butanoyl]amino]-1,6-diphenylhexan-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 18655548 |
| Molecular Formula | C44H51F3N6O8 |
| Molecular Weight | 848.92 g/mol |
| Exact Mass | 848.37 |
| IUPAC Name | [(2S,3S,5S)-2,5-bis[[(2S)-3-methyl-2-(pyridin-2-ylmethoxycarbonylamino)butanoyl]amino]-1,6-diphenylhexan-3-yl] 2,2,2-trifluoroacetate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccn1)C(=O)N[C@@H](Cc1ccccc1)C[C@H](OC(=O)C(F)(F)F)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)OCc1ccccn1)C(C)C |
| InChI | InChI=1S/C44H51F3N6O8/c1-28(2)37(52-42(57)59-26-32-19-11-13-21-48-32)39(54)50-34(23-30-15-7-5-8-16-30)25-36(61-41(56)44(45,46)47)35(24-31-17-9-6-10-18-31)51-40(55)38(29(3)4)53-43(58)60-27-33-20-12-14-22-49-33/h5-22,28-29,34-38H,23-27H2,1-4H3,(H,50,54)(H,51,55)(H,52,57)(H,53,58)/t34-,35-,36-,37-,38-/m0/s1 |
| InChIKey | WDFGQSGYCMBUOM-LQWITFIISA-N |
| XLogP | 6.00 |
| TPSA | 186.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.92 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|