About (4S,5R)-5-(hydroxymethyl)thiolane-2,4-diol
(4S,5R)-5-(hydroxymethyl)thiolane-2,4-diol (PubChem CID 18655752) has the molecular formula C5H10O3S
and a molecular weight of 150.20 g/mol. Its IUPAC name is (4S,5R)-5-(hydroxymethyl)thiolane-2,4-diol.
Molecular Properties
| Compound Name | (4S,5R)-5-(hydroxymethyl)thiolane-2,4-diol |
| PubChem CID | 18655752 |
| Molecular Formula | C5H10O3S |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | (4S,5R)-5-(hydroxymethyl)thiolane-2,4-diol |
| SMILES | OC[C@H]1SC(O)C[C@@H]1O |
| InChI | InChI=1S/C5H10O3S/c6-2-4-3(7)1-5(8)9-4/h3-8H,1-2H2/t3-,4+,5?/m0/s1 |
| InChIKey | JIHFSQHLECEOON-PYHARJCCSA-N |
| XLogP | -0.84 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4S,5R)-5-(hydroxymethyl)thiolane-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5R)-5-(hydroxymethyl)thiolane-2,4-diol?
The IUPAC name of (4S,5R)-5-(hydroxymethyl)thiolane-2,4-diol (CID 18655752) is (4S,5R)-5-(hydroxymethyl)thiolane-2,4-diol.
What is the SMILES notation for (4S,5R)-5-(hydroxymethyl)thiolane-2,4-diol?
The canonical SMILES for (4S,5R)-5-(hydroxymethyl)thiolane-2,4-diol is OC[C@H]1SC(O)C[C@@H]1O.
What is the InChIKey of (4S,5R)-5-(hydroxymethyl)thiolane-2,4-diol?
The InChIKey is JIHFSQHLECEOON-PYHARJCCSA-N. The full InChI is InChI=1S/C5H10O3S/c6-2-4-3(7)1-5(8)9-4/h3-8H,1-2H2/t3-,4+,5?/m0/s1.
What are the key properties of (4S,5R)-5-(hydroxymethyl)thiolane-2,4-diol?
(4S,5R)-5-(hydroxymethyl)thiolane-2,4-diol has a molecular weight of 150.20 g/mol, XLogP of -0.84, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5R)-5-(hydroxymethyl)thiolane-2,4-diol is sourced from PubChem (CID 18655752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).