C14H20O10 — CID 18655961
(2R,3S,4R,5R)-2,3,4-triacetyl-2,3,4,5,6-pentahydroxy-7-oxooctanal (PubChem CID 18655961) has the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4-triacetyl-2,3,4,5,6-pentahydroxy-7-oxooctanal.
| Compound Name | (2R,3S,4R,5R)-2,3,4-triacetyl-2,3,4,5,6-pentahydroxy-7-oxooctanal |
|---|---|
| PubChem CID | 18655961 |
| Molecular Formula | C14H20O10 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4-triacetyl-2,3,4,5,6-pentahydroxy-7-oxooctanal |
| SMILES | CC(=O)C(O)[C@@H](O)[C@](O)(C(C)=O)[C@@](O)(C(C)=O)[C@@](O)(C=O)C(C)=O |
| InChI | InChI=1S/C14H20O10/c1-6(16)10(20)11(21)13(23,8(3)18)14(24,9(4)19)12(22,5-15)7(2)17/h5,10-11,20-24H,1-4H3/t10?,11-,12-,13-,14-/m1/s1 |
| InChIKey | RZBDNMLCXKERMD-OOAQSJESSA-N |
| XLogP | -3.54 |
| TPSA | 186.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|