C25H32O7S — CID 18655981
(1S)-1-[(3aS,4S,6S,6aR)-2,2-dimethyl-4-(3-phenylpropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(4-methylphenyl)sulfonylethanol (PubChem CID 18655981) has the molecular formula C25H32O7S and a molecular weight of 476.59 g/mol. Its IUPAC name is (1S)-1-[(3aS,4S,6S,6aR)-2,2-dimethyl-4-(3-phenylpropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(4-methylphenyl)sulfonylethanol.
| Compound Name | (1S)-1-[(3aS,4S,6S,6aR)-2,2-dimethyl-4-(3-phenylpropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(4-methylphenyl)sulfonylethanol |
|---|---|
| PubChem CID | 18655981 |
| Molecular Formula | C25H32O7S |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | (1S)-1-[(3aS,4S,6S,6aR)-2,2-dimethyl-4-(3-phenylpropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(4-methylphenyl)sulfonylethanol |
| SMILES | Cc1ccc(S(=O)(=O)[C@](C)(O)[C@H]2O[C@H](OCCCc3ccccc3)[C@H]3OC(C)(C)O[C@H]32)cc1 |
| InChI | InChI=1S/C25H32O7S/c1-17-12-14-19(15-13-17)33(27,28)25(4,26)22-20-21(32-24(2,3)31-20)23(30-22)29-16-8-11-18-9-6-5-7-10-18/h5-7,9-10,12-15,20-23,26H,8,11,16H2,1-4H3/t20-,21+,22+,23+,25+/m1/s1 |
| InChIKey | LAXDIXSGPDCQIC-FCRIMTMASA-N |
| XLogP | 3.37 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|