C25H32O8S — CID 18655982
(1S)-1-[(3aS,4S,6R,6aS)-2,2-dimethyl-4-(3-phenylpropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-(4-methylphenyl)sulfonylethane-1,2-diol (PubChem CID 18655982) has the molecular formula C25H32O8S and a molecular weight of 492.59 g/mol. Its IUPAC name is (1S)-1-[(3aS,4S,6R,6aS)-2,2-dimethyl-4-(3-phenylpropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-(4-methylphenyl)sulfonylethane-1,2-diol.
| Compound Name | (1S)-1-[(3aS,4S,6R,6aS)-2,2-dimethyl-4-(3-phenylpropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-(4-methylphenyl)sulfonylethane-1,2-diol |
|---|---|
| PubChem CID | 18655982 |
| Molecular Formula | C25H32O8S |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | (1S)-1-[(3aS,4S,6R,6aS)-2,2-dimethyl-4-(3-phenylpropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-(4-methylphenyl)sulfonylethane-1,2-diol |
| SMILES | Cc1ccc(S(=O)(=O)C(O)[C@@H](O)[C@H]2O[C@H](OCCCc3ccccc3)[C@H]3OC(C)(C)O[C@H]32)cc1 |
| InChI | InChI=1S/C25H32O8S/c1-16-11-13-18(14-12-16)34(28,29)23(27)19(26)20-21-22(33-25(2,3)32-21)24(31-20)30-15-7-10-17-8-5-4-6-9-17/h4-6,8-9,11-14,19-24,26-27H,7,10,15H2,1-3H3/t19-,20+,21-,22-,23?,24-/m0/s1 |
| InChIKey | LLIGQWRMXXYHOB-YWDBJZARSA-N |
| XLogP | 2.34 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|