C17H21F2N3O2 — CID 18657633
2-[(1R)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]-4-(3-methylbutyl)-1,2,4-triazol-3-one (PubChem CID 18657633) has the molecular formula C17H21F2N3O2 and a molecular weight of 337.37 g/mol. Its IUPAC name is 2-[(1R)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]-4-(3-methylbutyl)-1,2,4-triazol-3-one.
| Compound Name | 2-[(1R)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]-4-(3-methylbutyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 18657633 |
| Molecular Formula | C17H21F2N3O2 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2-[(1R)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]-4-(3-methylbutyl)-1,2,4-triazol-3-one |
| SMILES | CC(C)CCn1cnn([C@H](C)[C@@]2(c3ccc(F)cc3F)CO2)c1=O |
| InChI | InChI=1S/C17H21F2N3O2/c1-11(2)6-7-21-10-20-22(16(21)23)12(3)17(9-24-17)14-5-4-13(18)8-15(14)19/h4-5,8,10-12H,6-7,9H2,1-3H3/t12-,17-/m1/s1 |
| InChIKey | INALODLBKBRNBO-SJKOYZFVSA-N |
| XLogP | 2.86 |
| TPSA | 52.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|