C24H43N5O6Si — CID 18657848
tert-butyl 3-azido-4-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]-2-oxopyrrolidine-1-carboxylate (PubChem CID 18657848) has the molecular formula C24H43N5O6Si and a molecular weight of 525.72 g/mol. Its IUPAC name is tert-butyl 3-azido-4-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]-2-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-azido-4-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]-2-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 18657848 |
| Molecular Formula | C24H43N5O6Si |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | tert-butyl 3-azido-4-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]-2-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC([C@@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)CN2C(=O)OC(C)(C)C)C(N=[N+]=[N-])C1=O |
| InChI | InChI=1S/C24H43N5O6Si/c1-22(2,3)33-20(31)28-13-15(35-36(10,11)24(7,8)9)12-17(28)16-14-29(19(30)18(16)26-27-25)21(32)34-23(4,5)6/h15-18H,12-14H2,1-11H3/t15-,16?,17+,18?/m1/s1 |
| InChIKey | CYBZVZVTMVFKQW-ZLZJIPBDSA-N |
| XLogP | 5.46 |
| TPSA | 134.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|