About 4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]pyrrolidin-2-one
4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]pyrrolidin-2-one (PubChem CID 18657856) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]pyrrolidin-2-one |
| PubChem CID | 18657856 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]pyrrolidin-2-one |
| SMILES | O=C1CC([C@@H]2C[C@@H](O)CN2)CN1 |
| InChI | InChI=1S/C8H14N2O2/c11-6-2-7(9-4-6)5-1-8(12)10-3-5/h5-7,9,11H,1-4H2,(H,10,12)/t5?,6-,7+/m1/s1 |
| InChIKey | GMINVDDTTRFBNJ-FWPZAIACSA-N |
| XLogP | -1.15 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]pyrrolidin-2-one?
The IUPAC name of 4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]pyrrolidin-2-one (CID 18657856) is 4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]pyrrolidin-2-one.
What is the SMILES notation for 4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]pyrrolidin-2-one?
The canonical SMILES for 4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]pyrrolidin-2-one is O=C1CC([C@@H]2C[C@@H](O)CN2)CN1.
What is the InChIKey of 4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]pyrrolidin-2-one?
The InChIKey is GMINVDDTTRFBNJ-FWPZAIACSA-N. The full InChI is InChI=1S/C8H14N2O2/c11-6-2-7(9-4-6)5-1-8(12)10-3-5/h5-7,9,11H,1-4H2,(H,10,12)/t5?,6-,7+/m1/s1.
What are the key properties of 4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]pyrrolidin-2-one?
4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]pyrrolidin-2-one has a molecular weight of 170.21 g/mol, XLogP of -1.15, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]pyrrolidin-2-one is sourced from PubChem (CID 18657856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).