C21H21FO6 — CID 18658036
[(4aR,6S,7R,8S,8aR)-7-fluoro-8-hydroxy-6-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-yl]-phenylmethanone (PubChem CID 18658036) has the molecular formula C21H21FO6 and a molecular weight of 388.39 g/mol. Its IUPAC name is [(4aR,6S,7R,8S,8aR)-7-fluoro-8-hydroxy-6-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-yl]-phenylmethanone.
| Compound Name | [(4aR,6S,7R,8S,8aR)-7-fluoro-8-hydroxy-6-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-yl]-phenylmethanone |
|---|---|
| PubChem CID | 18658036 |
| Molecular Formula | C21H21FO6 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [(4aR,6S,7R,8S,8aR)-7-fluoro-8-hydroxy-6-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-yl]-phenylmethanone |
| SMILES | CO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@](O)(C(=O)c2ccccc2)[C@H]1F |
| InChI | InChI=1S/C21H21FO6/c1-25-20-16(22)21(24,17(23)13-8-4-2-5-9-13)18-15(27-20)12-26-19(28-18)14-10-6-3-7-11-14/h2-11,15-16,18-20,24H,12H2,1H3/t15-,16+,18-,19?,20+,21-/m1/s1 |
| InChIKey | HXIOYVBSAGIKSP-WSXJJDEASA-N |
| XLogP | 2.42 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |