About (2R)-2-phenoxyoxolane-3,4-diol
(2R)-2-phenoxyoxolane-3,4-diol (PubChem CID 18658260) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is (2R)-2-phenoxyoxolane-3,4-diol.
Molecular Properties
| Compound Name | (2R)-2-phenoxyoxolane-3,4-diol |
| PubChem CID | 18658260 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (2R)-2-phenoxyoxolane-3,4-diol |
| SMILES | OC1CO[C@H](Oc2ccccc2)C1O |
| InChI | InChI=1S/C10H12O4/c11-8-6-13-10(9(8)12)14-7-4-2-1-3-5-7/h1-5,8-12H,6H2/t8?,9?,10-/m1/s1 |
| InChIKey | RXUZMXMAXASFEK-UDNWOFFPSA-N |
| XLogP | 0.14 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-phenoxyoxolane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-phenoxyoxolane-3,4-diol?
The IUPAC name of (2R)-2-phenoxyoxolane-3,4-diol (CID 18658260) is (2R)-2-phenoxyoxolane-3,4-diol.
What is the SMILES notation for (2R)-2-phenoxyoxolane-3,4-diol?
The canonical SMILES for (2R)-2-phenoxyoxolane-3,4-diol is OC1CO[C@H](Oc2ccccc2)C1O.
What is the InChIKey of (2R)-2-phenoxyoxolane-3,4-diol?
The InChIKey is RXUZMXMAXASFEK-UDNWOFFPSA-N. The full InChI is InChI=1S/C10H12O4/c11-8-6-13-10(9(8)12)14-7-4-2-1-3-5-7/h1-5,8-12H,6H2/t8?,9?,10-/m1/s1.
What are the key properties of (2R)-2-phenoxyoxolane-3,4-diol?
(2R)-2-phenoxyoxolane-3,4-diol has a molecular weight of 196.20 g/mol, XLogP of 0.14, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-phenoxyoxolane-3,4-diol is sourced from PubChem (CID 18658260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).