C29H36N2O4Si — CID 18658709
1-[(2R,4S,5R)-5-but-3-enyl-4-[tert-butyl(diphenyl)silyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 18658709) has the molecular formula C29H36N2O4Si and a molecular weight of 504.70 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-but-3-enyl-4-[tert-butyl(diphenyl)silyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-5-but-3-enyl-4-[tert-butyl(diphenyl)silyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 18658709 |
| Molecular Formula | C29H36N2O4Si |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 1-[(2R,4S,5R)-5-but-3-enyl-4-[tert-butyl(diphenyl)silyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | C=CCC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H36N2O4Si/c1-6-7-18-24-25(19-26(34-24)31-20-21(2)27(32)30-28(31)33)35-36(29(3,4)5,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h6,8-17,20,24-26H,1,7,18-19H2,2-5H3,(H,30,32,33)/t24-,25+,26-/m1/s1 |
| InChIKey | HREKIURNWNTNKG-UODIDJSMSA-N |
| XLogP | 4.04 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|