About 2,2-difluoroethyl 4-(4-decylphenyl)cyclohexane-1-carboxylate
2,2-difluoroethyl 4-(4-decylphenyl)cyclohexane-1-carboxylate (PubChem CID 18659018) has the molecular formula C25H38F2O2
and a molecular weight of 408.57 g/mol. Its IUPAC name is 2,2-difluoroethyl 4-(4-decylphenyl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 2,2-difluoroethyl 4-(4-decylphenyl)cyclohexane-1-carboxylate |
| PubChem CID | 18659018 |
| Molecular Formula | C25H38F2O2 |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 2,2-difluoroethyl 4-(4-decylphenyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCCCCCc1ccc(C2CCC(C(=O)OCC(F)F)CC2)cc1 |
| InChI | InChI=1S/C25H38F2O2/c1-2-3-4-5-6-7-8-9-10-20-11-13-21(14-12-20)22-15-17-23(18-16-22)25(28)29-19-24(26)27/h11-14,22-24H,2-10,15-19H2,1H3 |
| InChIKey | JCQUMSLJKIVLEH-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoroethyl 4-(4-decylphenyl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoroethyl 4-(4-decylphenyl)cyclohexane-1-carboxylate?
The IUPAC name of 2,2-difluoroethyl 4-(4-decylphenyl)cyclohexane-1-carboxylate (CID 18659018) is 2,2-difluoroethyl 4-(4-decylphenyl)cyclohexane-1-carboxylate.
What is the SMILES notation for 2,2-difluoroethyl 4-(4-decylphenyl)cyclohexane-1-carboxylate?
The canonical SMILES for 2,2-difluoroethyl 4-(4-decylphenyl)cyclohexane-1-carboxylate is CCCCCCCCCCc1ccc(C2CCC(C(=O)OCC(F)F)CC2)cc1.
What is the InChIKey of 2,2-difluoroethyl 4-(4-decylphenyl)cyclohexane-1-carboxylate?
The InChIKey is JCQUMSLJKIVLEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H38F2O2/c1-2-3-4-5-6-7-8-9-10-20-11-13-21(14-12-20)22-15-17-23(18-16-22)25(28)29-19-24(26)27/h11-14,22-24H,2-10,15-19H2,1H3.
What are the key properties of 2,2-difluoroethyl 4-(4-decylphenyl)cyclohexane-1-carboxylate?
2,2-difluoroethyl 4-(4-decylphenyl)cyclohexane-1-carboxylate has a molecular weight of 408.57 g/mol, XLogP of 7.45, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoroethyl 4-(4-decylphenyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 18659018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).