About 2,2-difluoroethyl 4-(4-nonylphenyl)cyclohexane-1-carboxylate
2,2-difluoroethyl 4-(4-nonylphenyl)cyclohexane-1-carboxylate (PubChem CID 18659028) has the molecular formula C24H36F2O2
and a molecular weight of 394.55 g/mol. Its IUPAC name is 2,2-difluoroethyl 4-(4-nonylphenyl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 2,2-difluoroethyl 4-(4-nonylphenyl)cyclohexane-1-carboxylate |
| PubChem CID | 18659028 |
| Molecular Formula | C24H36F2O2 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 2,2-difluoroethyl 4-(4-nonylphenyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCCCCc1ccc(C2CCC(C(=O)OCC(F)F)CC2)cc1 |
| InChI | InChI=1S/C24H36F2O2/c1-2-3-4-5-6-7-8-9-19-10-12-20(13-11-19)21-14-16-22(17-15-21)24(27)28-18-23(25)26/h10-13,21-23H,2-9,14-18H2,1H3 |
| InChIKey | FVCOFIOCNOKMEC-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoroethyl 4-(4-nonylphenyl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoroethyl 4-(4-nonylphenyl)cyclohexane-1-carboxylate?
The IUPAC name of 2,2-difluoroethyl 4-(4-nonylphenyl)cyclohexane-1-carboxylate (CID 18659028) is 2,2-difluoroethyl 4-(4-nonylphenyl)cyclohexane-1-carboxylate.
What is the SMILES notation for 2,2-difluoroethyl 4-(4-nonylphenyl)cyclohexane-1-carboxylate?
The canonical SMILES for 2,2-difluoroethyl 4-(4-nonylphenyl)cyclohexane-1-carboxylate is CCCCCCCCCc1ccc(C2CCC(C(=O)OCC(F)F)CC2)cc1.
What is the InChIKey of 2,2-difluoroethyl 4-(4-nonylphenyl)cyclohexane-1-carboxylate?
The InChIKey is FVCOFIOCNOKMEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H36F2O2/c1-2-3-4-5-6-7-8-9-19-10-12-20(13-11-19)21-14-16-22(17-15-21)24(27)28-18-23(25)26/h10-13,21-23H,2-9,14-18H2,1H3.
What are the key properties of 2,2-difluoroethyl 4-(4-nonylphenyl)cyclohexane-1-carboxylate?
2,2-difluoroethyl 4-(4-nonylphenyl)cyclohexane-1-carboxylate has a molecular weight of 394.55 g/mol, XLogP of 7.06, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoroethyl 4-(4-nonylphenyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 18659028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).