About 2-(difluoromethoxy)-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene
2-(difluoromethoxy)-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene (PubChem CID 18659088) has the molecular formula C22H30F4O
and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-(difluoromethoxy)-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene.
Molecular Properties
| Compound Name | 2-(difluoromethoxy)-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene |
| PubChem CID | 18659088 |
| Molecular Formula | C22H30F4O |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 2-(difluoromethoxy)-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene |
| SMILES | CCCC1CCC(C2CCC(c3cc(F)c(OC(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C22H30F4O/c1-2-3-14-4-6-15(7-5-14)16-8-10-17(11-9-16)18-12-19(23)21(20(24)13-18)27-22(25)26/h12-17,22H,2-11H2,1H3 |
| InChIKey | GMCGTWFHMSDTJZ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(difluoromethoxy)-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethoxy)-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene?
The IUPAC name of 2-(difluoromethoxy)-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene (CID 18659088) is 2-(difluoromethoxy)-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene.
What is the SMILES notation for 2-(difluoromethoxy)-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene?
The canonical SMILES for 2-(difluoromethoxy)-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene is CCCC1CCC(C2CCC(c3cc(F)c(OC(F)F)c(F)c3)CC2)CC1.
What is the InChIKey of 2-(difluoromethoxy)-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene?
The InChIKey is GMCGTWFHMSDTJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30F4O/c1-2-3-14-4-6-15(7-5-14)16-8-10-17(11-9-16)18-12-19(23)21(20(24)13-18)27-22(25)26/h12-17,22H,2-11H2,1H3.
What are the key properties of 2-(difluoromethoxy)-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene?
2-(difluoromethoxy)-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene has a molecular weight of 386.47 g/mol, XLogP of 7.45, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethoxy)-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene is sourced from PubChem (CID 18659088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).