C8H5F9O2 — CID 18659314
(E)-5,5,5-trifluoro-2-methyl-4,4-bis(trifluoromethyl)pent-2-enoic acid (PubChem CID 18659314) has the molecular formula C8H5F9O2 and a molecular weight of 304.11 g/mol. Its IUPAC name is (E)-5,5,5-trifluoro-2-methyl-4,4-bis(trifluoromethyl)pent-2-enoic acid.
| Compound Name | (E)-5,5,5-trifluoro-2-methyl-4,4-bis(trifluoromethyl)pent-2-enoic acid |
|---|---|
| PubChem CID | 18659314 |
| Molecular Formula | C8H5F9O2 |
| Molecular Weight | 304.11 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | (E)-5,5,5-trifluoro-2-methyl-4,4-bis(trifluoromethyl)pent-2-enoic acid |
| SMILES | C/C(=C\C(C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H5F9O2/c1-3(4(18)19)2-5(6(9,10)11,7(12,13)14)8(15,16)17/h2H,1H3,(H,18,19)/b3-2+ |
| InChIKey | GWWXKFUHGDSSKM-NSCUHMNNSA-N |
| XLogP | 3.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.11 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|