C17H23N5O — CID 18659387
(11R,15S)-5-cyclopentyl-4,8-dimethyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one (PubChem CID 18659387) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is (11R,15S)-5-cyclopentyl-4,8-dimethyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one.
| Compound Name | (11R,15S)-5-cyclopentyl-4,8-dimethyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one |
|---|---|
| PubChem CID | 18659387 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | (11R,15S)-5-cyclopentyl-4,8-dimethyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one |
| SMILES | Cc1nc2c(n1C1CCCC1)C(=O)N(C)C1=N[C@@H]3CCC[C@@H]3N12 |
| InChI | InChI=1S/C17H23N5O/c1-10-18-15-14(21(10)11-6-3-4-7-11)16(23)20(2)17-19-12-8-5-9-13(12)22(15)17/h11-13H,3-9H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | XYFNNRCDAGOOJH-OLZOCXBDSA-N |
| XLogP | 2.49 |
| TPSA | 53.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |