C26H46N8O8 — CID 18659496
[4-[(2S,3R)-3-[4-[[(2S)-2,6-diaminohexanoyl]oxymethyl]-3,5-dioxopiperazin-1-yl]butan-2-yl]-2,6-dioxopiperazin-1-yl]methyl (2S)-2,6-diaminohexanoate (PubChem CID 18659496) has the molecular formula C26H46N8O8 and a molecular weight of 598.70 g/mol. Its IUPAC name is [4-[(2S,3R)-3-[4-[[(2S)-2,6-diaminohexanoyl]oxymethyl]-3,5-dioxopiperazin-1-yl]butan-2-yl]-2,6-dioxopiperazin-1-yl]methyl (2S)-2,6-diaminohexanoate.
| Compound Name | [4-[(2S,3R)-3-[4-[[(2S)-2,6-diaminohexanoyl]oxymethyl]-3,5-dioxopiperazin-1-yl]butan-2-yl]-2,6-dioxopiperazin-1-yl]methyl (2S)-2,6-diaminohexanoate |
|---|---|
| PubChem CID | 18659496 |
| Molecular Formula | C26H46N8O8 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.34 |
| IUPAC Name | [4-[(2S,3R)-3-[4-[[(2S)-2,6-diaminohexanoyl]oxymethyl]-3,5-dioxopiperazin-1-yl]butan-2-yl]-2,6-dioxopiperazin-1-yl]methyl (2S)-2,6-diaminohexanoate |
| SMILES | C[C@H]([C@H](C)N1CC(=O)N(COC(=O)[C@@H](N)CCCCN)C(=O)C1)N1CC(=O)N(COC(=O)[C@@H](N)CCCCN)C(=O)C1 |
| InChI | InChI=1S/C26H46N8O8/c1-17(31-11-21(35)33(22(36)12-31)15-41-25(39)19(29)7-3-5-9-27)18(2)32-13-23(37)34(24(38)14-32)16-42-26(40)20(30)8-4-6-10-28/h17-20H,3-16,27-30H2,1-2H3/t17-,18+,19-,20-/m0/s1 |
| InChIKey | UYNOUYFJKIVDSL-YRPNKDGESA-N |
| XLogP | -2.98 |
| TPSA | 237.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|