About CID 18659547
CID 18659547 (PubChem CID 18659547) has the molecular formula C34H49NO9
and a molecular weight of 615.76 g/mol.
Molecular Properties
| Compound Name | CID 18659547 |
| PubChem CID | 18659547 |
| Molecular Formula | C34H49NO9 |
| Molecular Weight | 615.76 g/mol |
| Exact Mass | 615.34 |
| IUPAC Name | — |
| SMILES | CC(=O)O[C@@H]1[C@@H](OCCCCCCNC(=O)OCc2ccccc2)[C@@H]2OC3(CCCCC3)O[C@H]2[C@@H]2OC3(CCCCC3)O[C@H]12 |
| InChI | InChI=1S/C34H49NO9/c1-24(36)40-27-26(38-22-14-3-2-13-21-35-32(37)39-23-25-15-7-4-8-16-25)28-30(43-33(41-28)17-9-5-10-18-33)31-29(27)42-34(44-31)19-11-6-12-20-34/h4,7-8,15-16,26-31H,2-3,5-6,9-14,17-23H2,1H3,(H,35,37)/t26-,27-,28+,29-,30-,31-/m1/s1 |
| InChIKey | OPNKEJBCMXQMKS-UJDDCBASSA-N |
| XLogP | 5.69 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 615.76 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 18659547 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18659547?
The IUPAC name of CID 18659547 (CID 18659547) is not available.
What is the SMILES notation for CID 18659547?
The canonical SMILES for CID 18659547 is CC(=O)O[C@@H]1[C@@H](OCCCCCCNC(=O)OCc2ccccc2)[C@@H]2OC3(CCCCC3)O[C@H]2[C@@H]2OC3(CCCCC3)O[C@H]12.
What is the InChIKey of CID 18659547?
The InChIKey is OPNKEJBCMXQMKS-UJDDCBASSA-N. The full InChI is InChI=1S/C34H49NO9/c1-24(36)40-27-26(38-22-14-3-2-13-21-35-32(37)39-23-25-15-7-4-8-16-25)28-30(43-33(41-28)17-9-5-10-18-33)31-29(27)42-34(44-31)19-11-6-12-20-34/h4,7-8,15-16,26-31H,2-3,5-6,9-14,17-23H2,1H3,(H,35,37)/t26-,27-,28+,29-,30-,31-/m1/s1.
What are the key properties of CID 18659547?
CID 18659547 has a molecular weight of 615.76 g/mol, XLogP of 5.69, 11 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18659547 is sourced from PubChem (CID 18659547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).