About CID 18659548
CID 18659548 (PubChem CID 18659548) has the molecular formula C38H52O8
and a molecular weight of 636.83 g/mol.
Molecular Properties
| Compound Name | CID 18659548 |
| PubChem CID | 18659548 |
| Molecular Formula | C38H52O8 |
| Molecular Weight | 636.83 g/mol |
| Exact Mass | 636.37 |
| IUPAC Name | — |
| SMILES | O[C@@H]1[C@@H](OCCCCC(COCc2ccccc2)OCc2ccccc2)[C@@H]2OC3(CCCCC3)O[C@H]2[C@@H]2OC3(CCCCC3)O[C@H]12 |
| InChI | InChI=1S/C38H52O8/c39-31-32(34-36(46-38(44-34)22-12-4-13-23-38)35-33(31)43-37(45-35)20-10-3-11-21-37)41-24-14-9-19-30(42-26-29-17-7-2-8-18-29)27-40-25-28-15-5-1-6-16-28/h1-2,5-8,15-18,30-36,39H,3-4,9-14,19-27H2/t30?,31-,32-,33-,34+,35-,36-/m1/s1 |
| InChIKey | MNMPUYWURGVYEQ-AIMPYYCSSA-N |
| XLogP | 6.61 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 636.83 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 18659548 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18659548?
The IUPAC name of CID 18659548 (CID 18659548) is not available.
What is the SMILES notation for CID 18659548?
The canonical SMILES for CID 18659548 is O[C@@H]1[C@@H](OCCCCC(COCc2ccccc2)OCc2ccccc2)[C@@H]2OC3(CCCCC3)O[C@H]2[C@@H]2OC3(CCCCC3)O[C@H]12.
What is the InChIKey of CID 18659548?
The InChIKey is MNMPUYWURGVYEQ-AIMPYYCSSA-N. The full InChI is InChI=1S/C38H52O8/c39-31-32(34-36(46-38(44-34)22-12-4-13-23-38)35-33(31)43-37(45-35)20-10-3-11-21-37)41-24-14-9-19-30(42-26-29-17-7-2-8-18-29)27-40-25-28-15-5-1-6-16-28/h1-2,5-8,15-18,30-36,39H,3-4,9-14,19-27H2/t30?,31-,32-,33-,34+,35-,36-/m1/s1.
What are the key properties of CID 18659548?
CID 18659548 has a molecular weight of 636.83 g/mol, XLogP of 6.61, 13 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18659548 is sourced from PubChem (CID 18659548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).