C19H29NO5S — CID 18659799
(2S)-2-[[(2S)-2-benzyl-3-tert-butylsulfonylpropanoyl]amino]-3-methylbutanoic acid (PubChem CID 18659799) has the molecular formula C19H29NO5S and a molecular weight of 383.51 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-benzyl-3-tert-butylsulfonylpropanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-benzyl-3-tert-butylsulfonylpropanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18659799 |
| Molecular Formula | C19H29NO5S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (2S)-2-[[(2S)-2-benzyl-3-tert-butylsulfonylpropanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@H](Cc1ccccc1)CS(=O)(=O)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C19H29NO5S/c1-13(2)16(18(22)23)20-17(21)15(11-14-9-7-6-8-10-14)12-26(24,25)19(3,4)5/h6-10,13,15-16H,11-12H2,1-5H3,(H,20,21)(H,22,23)/t15-,16+/m1/s1 |
| InChIKey | GCDMOIVLLROTGP-CVEARBPZSA-N |
| XLogP | 2.28 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |