C14H24O8 — CID 18660040
(5S)-5-hydroxy-2,7-dimethyl-5-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]octane-3,4,6-trione (PubChem CID 18660040) has the molecular formula C14H24O8 and a molecular weight of 320.34 g/mol. Its IUPAC name is (5S)-5-hydroxy-2,7-dimethyl-5-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]octane-3,4,6-trione.
| Compound Name | (5S)-5-hydroxy-2,7-dimethyl-5-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]octane-3,4,6-trione |
|---|---|
| PubChem CID | 18660040 |
| Molecular Formula | C14H24O8 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (5S)-5-hydroxy-2,7-dimethyl-5-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]octane-3,4,6-trione |
| SMILES | CC(C)C(=O)C(=O)[C@]([C@H]([C@@H]([C@@H](CO)O)O)O)(C(=O)C(C)C)O |
| InChI | InChI=1S/C14H24O8/c1-6(2)9(17)12(20)14(22,11(19)7(3)4)13(21)10(18)8(16)5-15/h6-8,10,13,15-16,18,21-22H,5H2,1-4H3/t8-,10-,13+,14+/m1/s1 |
| InChIKey | SOFLBXRXBDRHOR-PGOKHVGTSA-N |
| XLogP | -1.70 |
| TPSA | 152.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | 431 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|