C27H43NO2S — CID 18660073
(2S,3aS,3bS,5aR,9aR,9bS,11aR)-N-(3-ethylhexan-3-yl)-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]thiochromene-2-carboxamide (PubChem CID 18660073) has the molecular formula C27H43NO2S and a molecular weight of 445.71 g/mol. Its IUPAC name is (2S,3aS,3bS,5aR,9aR,9bS,11aR)-N-(3-ethylhexan-3-yl)-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]thiochromene-2-carboxamide.
| Compound Name | (2S,3aS,3bS,5aR,9aR,9bS,11aR)-N-(3-ethylhexan-3-yl)-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]thiochromene-2-carboxamide |
|---|---|
| PubChem CID | 18660073 |
| Molecular Formula | C27H43NO2S |
| Molecular Weight | 445.71 g/mol |
| Exact Mass | 445.30 |
| IUPAC Name | (2S,3aS,3bS,5aR,9aR,9bS,11aR)-N-(3-ethylhexan-3-yl)-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]thiochromene-2-carboxamide |
| SMILES | CCCC(CC)(CC)NC(=O)[C@H]1C[C@H]2[C@@H]3CC[C@H]4SC(=O)C=C[C@]4(C)[C@H]3CC[C@]2(C)C1 |
| InChI | InChI=1S/C27H43NO2S/c1-6-13-27(7-2,8-3)28-24(30)18-16-21-19-9-10-22-26(5,15-12-23(29)31-22)20(19)11-14-25(21,4)17-18/h12,15,18-22H,6-11,13-14,16-17H2,1-5H3,(H,28,30)/t18-,19+,20-,21-,22+,25+,26+/m0/s1 |
| InChIKey | CTIHOAPYWJLUPO-ZQOKKQOZSA-N |
| XLogP | 6.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.71 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|