About prop-2-enyl N-[(2S,3S)-2-amino-3-methylpentyl]carbamate;hydrochloride
prop-2-enyl N-[(2S,3S)-2-amino-3-methylpentyl]carbamate;hydrochloride (PubChem CID 18660160) has the molecular formula C10H21ClN2O2
and a molecular weight of 236.74 g/mol. Its IUPAC name is prop-2-enyl N-[(2S,3S)-2-amino-3-methylpentyl]carbamate;hydrochloride.
Molecular Properties
| Compound Name | prop-2-enyl N-[(2S,3S)-2-amino-3-methylpentyl]carbamate;hydrochloride |
| PubChem CID | 18660160 |
| Molecular Formula | C10H21ClN2O2 |
| Molecular Weight | 236.74 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | prop-2-enyl N-[(2S,3S)-2-amino-3-methylpentyl]carbamate;hydrochloride |
| SMILES | C=CCOC(=O)NC[C@@H](N)[C@@H](C)CC.Cl |
| InChI | InChI=1S/C10H20N2O2.ClH/c1-4-6-14-10(13)12-7-9(11)8(3)5-2;/h4,8-9H,1,5-7,11H2,2-3H3,(H,12,13);1H/t8-,9+;/m0./s1 |
| InChIKey | PCXOKBBIWZSUEF-OULXEKPRSA-N |
| XLogP | 1.69 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.74 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl N-[(2S,3S)-2-amino-3-methylpentyl]carbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl N-[(2S,3S)-2-amino-3-methylpentyl]carbamate;hydrochloride?
The IUPAC name of prop-2-enyl N-[(2S,3S)-2-amino-3-methylpentyl]carbamate;hydrochloride (CID 18660160) is prop-2-enyl N-[(2S,3S)-2-amino-3-methylpentyl]carbamate;hydrochloride.
What is the SMILES notation for prop-2-enyl N-[(2S,3S)-2-amino-3-methylpentyl]carbamate;hydrochloride?
The canonical SMILES for prop-2-enyl N-[(2S,3S)-2-amino-3-methylpentyl]carbamate;hydrochloride is C=CCOC(=O)NC[C@@H](N)[C@@H](C)CC.Cl.
What is the InChIKey of prop-2-enyl N-[(2S,3S)-2-amino-3-methylpentyl]carbamate;hydrochloride?
The InChIKey is PCXOKBBIWZSUEF-OULXEKPRSA-N. The full InChI is InChI=1S/C10H20N2O2.ClH/c1-4-6-14-10(13)12-7-9(11)8(3)5-2;/h4,8-9H,1,5-7,11H2,2-3H3,(H,12,13);1H/t8-,9+;/m0./s1.
What are the key properties of prop-2-enyl N-[(2S,3S)-2-amino-3-methylpentyl]carbamate;hydrochloride?
prop-2-enyl N-[(2S,3S)-2-amino-3-methylpentyl]carbamate;hydrochloride has a molecular weight of 236.74 g/mol, XLogP of 1.69, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl N-[(2S,3S)-2-amino-3-methylpentyl]carbamate;hydrochloride is sourced from PubChem (CID 18660160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).