About N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(4-pyrimidin-4-ylphenyl)benzenesulfonamide
N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(4-pyrimidin-4-ylphenyl)benzenesulfonamide (PubChem CID 18660522) has the molecular formula C21H18N4O3S
and a molecular weight of 406.47 g/mol. Its IUPAC name is N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(4-pyrimidin-4-ylphenyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(4-pyrimidin-4-ylphenyl)benzenesulfonamide |
| PubChem CID | 18660522 |
| Molecular Formula | C21H18N4O3S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(4-pyrimidin-4-ylphenyl)benzenesulfonamide |
| SMILES | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ccncn3)cc2)c1C |
| InChI | InChI=1S/C21H18N4O3S/c1-14-15(2)24-28-21(14)25-29(26,27)20-6-4-3-5-18(20)16-7-9-17(10-8-16)19-11-12-22-13-23-19/h3-13,25H,1-2H3 |
| InChIKey | OXPDZJBNFCQMDY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(4-pyrimidin-4-ylphenyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(4-pyrimidin-4-ylphenyl)benzenesulfonamide?
The IUPAC name of N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(4-pyrimidin-4-ylphenyl)benzenesulfonamide (CID 18660522) is N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(4-pyrimidin-4-ylphenyl)benzenesulfonamide.
What is the SMILES notation for N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(4-pyrimidin-4-ylphenyl)benzenesulfonamide?
The canonical SMILES for N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(4-pyrimidin-4-ylphenyl)benzenesulfonamide is Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ccncn3)cc2)c1C.
What is the InChIKey of N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(4-pyrimidin-4-ylphenyl)benzenesulfonamide?
The InChIKey is OXPDZJBNFCQMDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N4O3S/c1-14-15(2)24-28-21(14)25-29(26,27)20-6-4-3-5-18(20)16-7-9-17(10-8-16)19-11-12-22-13-23-19/h3-13,25H,1-2H3.
What are the key properties of N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(4-pyrimidin-4-ylphenyl)benzenesulfonamide?
N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(4-pyrimidin-4-ylphenyl)benzenesulfonamide has a molecular weight of 406.47 g/mol, XLogP of 4.22, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(4-pyrimidin-4-ylphenyl)benzenesulfonamide is sourced from PubChem (CID 18660522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).