C9H17NO — CID 18660815
1-deuterio-2,2,6,6-tetramethylpiperidin-4-one (PubChem CID 18660815) has the molecular formula C9H17NO and a molecular weight of 156.25 g/mol. Its IUPAC name is 1-deuterio-2,2,6,6-tetramethylpiperidin-4-one.
| Compound Name | 1-deuterio-2,2,6,6-tetramethylpiperidin-4-one |
|---|---|
| PubChem CID | 18660815 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.14 |
| IUPAC Name | 1-deuterio-2,2,6,6-tetramethylpiperidin-4-one |
| SMILES | [2H]N1C(C)(C)CC(=O)CC1(C)C |
| InChI | InChI=1S/C9H17NO/c1-8(2)5-7(11)6-9(3,4)10-8/h10H,5-6H2,1-4H3/i/hD |
| InChIKey | JWUXJYZVKZKLTJ-DYCDLGHISA-N |
| XLogP | 1.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |