C32H40Cl2N2O3 — CID 18661835
[3-[(4aR,6S,8aS)-6-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate (PubChem CID 18661835) has the molecular formula C32H40Cl2N2O3 and a molecular weight of 571.59 g/mol. Its IUPAC name is [3-[(4aR,6S,8aS)-6-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[(4aR,6S,8aS)-6-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 18661835 |
| Molecular Formula | C32H40Cl2N2O3 |
| Molecular Weight | 571.59 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | [3-[(4aR,6S,8aS)-6-[[2-(3,4-dichlorophenyl)acetyl]-(2-methylpropyl)amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
| SMILES | C=CCN1CC[C@@]2(c3cccc(OC(C)=O)c3)C[C@@H](N(CC(C)C)C(=O)Cc3ccc(Cl)c(Cl)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C32H40Cl2N2O3/c1-5-14-35-15-13-32(25-7-6-8-28(18-25)39-23(4)37)19-27(11-10-26(32)21-35)36(20-22(2)3)31(38)17-24-9-12-29(33)30(34)16-24/h5-9,12,16,18,22,26-27H,1,10-11,13-15,17,19-21H2,2-4H3/t26-,27+,32+/m1/s1 |
| InChIKey | STTPJFKIYYPFGI-CUJVHAHTSA-N |
| XLogP | 6.94 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.59 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|