C29H34Cl2N2O3 — CID 18661850
[3-[(4aR,6S,8aS)-6-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate (PubChem CID 18661850) has the molecular formula C29H34Cl2N2O3 and a molecular weight of 529.51 g/mol. Its IUPAC name is [3-[(4aR,6S,8aS)-6-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[(4aR,6S,8aS)-6-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 18661850 |
| Molecular Formula | C29H34Cl2N2O3 |
| Molecular Weight | 529.51 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | [3-[(4aR,6S,8aS)-6-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
| SMILES | C=CCN1CC[C@@]2(c3cccc(OC(C)=O)c3)C[C@@H](N(C)C(=O)Cc3ccc(Cl)c(Cl)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C29H34Cl2N2O3/c1-4-13-33-14-12-29(22-6-5-7-25(17-22)36-20(2)34)18-24(10-9-23(29)19-33)32(3)28(35)16-21-8-11-26(30)27(31)15-21/h4-8,11,15,17,23-24H,1,9-10,12-14,16,18-19H2,2-3H3/t23-,24+,29+/m1/s1 |
| InChIKey | MXABNDOLYNORDU-UQARTHHBSA-N |
| XLogP | 5.92 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|