C30H38Cl2N2O2 — CID 18661864
N-[(4aR,6S,8aS)-4a-(3-hydroxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide (PubChem CID 18661864) has the molecular formula C30H38Cl2N2O2 and a molecular weight of 529.55 g/mol. Its IUPAC name is N-[(4aR,6S,8aS)-4a-(3-hydroxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide.
| Compound Name | N-[(4aR,6S,8aS)-4a-(3-hydroxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 18661864 |
| Molecular Formula | C30H38Cl2N2O2 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | N-[(4aR,6S,8aS)-4a-(3-hydroxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide |
| SMILES | C=CCN1CC[C@@]2(c3cccc(O)c3)C[C@@H](N(CC(C)C)C(=O)Cc3ccc(Cl)c(Cl)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C30H38Cl2N2O2/c1-4-13-33-14-12-30(23-6-5-7-26(35)17-23)18-25(10-9-24(30)20-33)34(19-21(2)3)29(36)16-22-8-11-27(31)28(32)15-22/h4-8,11,15,17,21,24-25,35H,1,9-10,12-14,16,18-20H2,2-3H3/t24-,25+,30+/m1/s1 |
| InChIKey | FFZGCKHLJXZNQG-GVQINVNESA-N |
| XLogP | 6.72 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|