C31H40Cl2N2O2 — CID 18661892
N-[(4aR,6S,8aS)-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide (PubChem CID 18661892) has the molecular formula C31H40Cl2N2O2 and a molecular weight of 543.58 g/mol. Its IUPAC name is N-[(4aR,6S,8aS)-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide.
| Compound Name | N-[(4aR,6S,8aS)-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 18661892 |
| Molecular Formula | C31H40Cl2N2O2 |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | N-[(4aR,6S,8aS)-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide |
| SMILES | C=CCN1CC[C@@]2(c3cccc(OC)c3)C[C@@H](N(CC(C)C)C(=O)Cc3ccc(Cl)c(Cl)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C31H40Cl2N2O2/c1-5-14-34-15-13-31(24-7-6-8-27(18-24)37-4)19-26(11-10-25(31)21-34)35(20-22(2)3)30(36)17-23-9-12-28(32)29(33)16-23/h5-9,12,16,18,22,25-26H,1,10-11,13-15,17,19-21H2,2-4H3/t25-,26+,31+/m1/s1 |
| InChIKey | NQQSSXQMGCTIDL-WQQNLHNWSA-N |
| XLogP | 7.03 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|