C28H34Cl2N2O2 — CID 18661894
N-[(4aR,6R,8aS)-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide (PubChem CID 18661894) has the molecular formula C28H34Cl2N2O2 and a molecular weight of 501.50 g/mol. Its IUPAC name is N-[(4aR,6R,8aS)-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide.
| Compound Name | N-[(4aR,6R,8aS)-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 18661894 |
| Molecular Formula | C28H34Cl2N2O2 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | N-[(4aR,6R,8aS)-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide |
| SMILES | C=CCN1CC[C@@]2(c3cccc(OC)c3)C[C@H](N(C)C(=O)Cc3ccc(Cl)c(Cl)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C28H34Cl2N2O2/c1-4-13-32-14-12-28(21-6-5-7-24(17-21)34-3)18-23(10-9-22(28)19-32)31(2)27(33)16-20-8-11-25(29)26(30)15-20/h4-8,11,15,17,22-23H,1,9-10,12-14,16,18-19H2,2-3H3/t22-,23-,28+/m1/s1 |
| InChIKey | RQJHACBHSDRGNX-MRJKTFCFSA-N |
| XLogP | 6.00 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|