About (2-prop-2-ynoxyphenyl) N-methylcarbamate
(2-prop-2-ynoxyphenyl) N-methylcarbamate (PubChem CID 18662) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is (2-prop-2-ynoxyphenyl) N-methylcarbamate.
Molecular Properties
| Compound Name | (2-prop-2-ynoxyphenyl) N-methylcarbamate |
| PubChem CID | 18662 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (2-prop-2-ynoxyphenyl) N-methylcarbamate |
| SMILES | C#CCOc1ccccc1OC(=O)NC |
| InChI | InChI=1S/C11H11NO3/c1-3-8-14-9-6-4-5-7-10(9)15-11(13)12-2/h1,4-7H,8H2,2H3,(H,12,13) |
| InChIKey | LQLIPNNDDMXSGM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-prop-2-ynoxyphenyl) N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-prop-2-ynoxyphenyl) N-methylcarbamate?
The IUPAC name of (2-prop-2-ynoxyphenyl) N-methylcarbamate (CID 18662) is (2-prop-2-ynoxyphenyl) N-methylcarbamate.
What is the SMILES notation for (2-prop-2-ynoxyphenyl) N-methylcarbamate?
The canonical SMILES for (2-prop-2-ynoxyphenyl) N-methylcarbamate is C#CCOc1ccccc1OC(=O)NC.
What is the InChIKey of (2-prop-2-ynoxyphenyl) N-methylcarbamate?
The InChIKey is LQLIPNNDDMXSGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c1-3-8-14-9-6-4-5-7-10(9)15-11(13)12-2/h1,4-7H,8H2,2H3,(H,12,13).
What are the key properties of (2-prop-2-ynoxyphenyl) N-methylcarbamate?
(2-prop-2-ynoxyphenyl) N-methylcarbamate has a molecular weight of 205.21 g/mol, XLogP of 1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-prop-2-ynoxyphenyl) N-methylcarbamate is sourced from PubChem (CID 18662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).