C28H43NO6 — CID 18662918
(2,5-dioxopyrrolidin-1-yl) (4R)-4-[(3R,7R,10S,13R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 18662918) has the molecular formula C28H43NO6 and a molecular weight of 489.65 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (4R)-4-[(3R,7R,10S,13R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (4R)-4-[(3R,7R,10S,13R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 18662918 |
| Molecular Formula | C28H43NO6 |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (4R)-4-[(3R,7R,10S,13R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | C[C@H](CCC(=O)ON1C(=O)CCC1=O)[C@H]1CCC2C3C(O)CC4C[C@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C28H43NO6/c1-16(4-9-25(34)35-29-23(32)7-8-24(29)33)19-5-6-20-26-21(11-13-28(19,20)3)27(2)12-10-18(30)14-17(27)15-22(26)31/h16-22,26,30-31H,4-15H2,1-3H3/t16-,17?,18-,19-,20?,21?,22?,26?,27+,28-/m1/s1 |
| InChIKey | ZPYAYMINPDNAPT-QSSNQNEOSA-N |
| XLogP | 4.00 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|