About 3-[[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-2H-indazole
3-[[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-2H-indazole (PubChem CID 18663219) has the molecular formula C20H18F6N4
and a molecular weight of 428.38 g/mol. Its IUPAC name is 3-[[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-2H-indazole.
Molecular Properties
| Compound Name | 3-[[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-2H-indazole |
| PubChem CID | 18663219 |
| Molecular Formula | C20H18F6N4 |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 3-[[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-2H-indazole |
| SMILES | FC(F)(F)c1cc(N2CCN(Cc3[nH]nc4ccccc34)CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18F6N4/c21-19(22,23)13-9-14(20(24,25)26)11-15(10-13)30-7-5-29(6-8-30)12-18-16-3-1-2-4-17(16)27-28-18/h1-4,9-11H,5-8,12H2,(H,27,28) |
| InChIKey | BEBHQUPOKHXDSV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-2H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-2H-indazole?
The IUPAC name of 3-[[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-2H-indazole (CID 18663219) is 3-[[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-2H-indazole.
What is the SMILES notation for 3-[[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-2H-indazole?
The canonical SMILES for 3-[[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-2H-indazole is FC(F)(F)c1cc(N2CCN(Cc3[nH]nc4ccccc34)CC2)cc(C(F)(F)F)c1.
What is the InChIKey of 3-[[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-2H-indazole?
The InChIKey is BEBHQUPOKHXDSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18F6N4/c21-19(22,23)13-9-14(20(24,25)26)11-15(10-13)30-7-5-29(6-8-30)12-18-16-3-1-2-4-17(16)27-28-18/h1-4,9-11H,5-8,12H2,(H,27,28).
What are the key properties of 3-[[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-2H-indazole?
3-[[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-2H-indazole has a molecular weight of 428.38 g/mol, XLogP of 4.92, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-2H-indazole is sourced from PubChem (CID 18663219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).