C19H20N2O5 — CID 18663486
(2S)-2-[(3,5-dimethylbenzoyl)-methylamino]-3-(4-nitrophenyl)propanoic acid (PubChem CID 18663486) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is (2S)-2-[(3,5-dimethylbenzoyl)-methylamino]-3-(4-nitrophenyl)propanoic acid.
| Compound Name | (2S)-2-[(3,5-dimethylbenzoyl)-methylamino]-3-(4-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 18663486 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (2S)-2-[(3,5-dimethylbenzoyl)-methylamino]-3-(4-nitrophenyl)propanoic acid |
| SMILES | Cc1cc(C)cc(C(=O)N(C)[C@@H](Cc2ccc([N+](=O)[O-])cc2)C(=O)O)c1 |
| InChI | InChI=1S/C19H20N2O5/c1-12-8-13(2)10-15(9-12)18(22)20(3)17(19(23)24)11-14-4-6-16(7-5-14)21(25)26/h4-10,17H,11H2,1-3H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | KNDQCXPCMHSBIB-KRWDZBQOSA-N |
| XLogP | 2.98 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|