C5H8O — CID 18664105
2,3,4,5,6-pentadeuterio-3,6-dihydro-2H-pyran (PubChem CID 18664105) has the molecular formula C5H8O and a molecular weight of 89.15 g/mol. Its IUPAC name is 2,3,4,5,6-pentadeuterio-3,6-dihydro-2H-pyran.
| Compound Name | 2,3,4,5,6-pentadeuterio-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 18664105 |
| Molecular Formula | C5H8O |
| Molecular Weight | 89.15 g/mol |
| Exact Mass | 89.09 |
| IUPAC Name | 2,3,4,5,6-pentadeuterio-3,6-dihydro-2H-pyran |
| SMILES | [2H]C1=C([2H])C([2H])C([2H])OC1[2H] |
| InChI | InChI=1S/C5H8O/c1-2-4-6-5-3-1/h1-2H,3-5H2/i1D,2D,3D,4D,5D |
| InChIKey | MUGSKSNNEORSJG-RALIUCGRSA-N |
| XLogP | 0.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 89.15 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|