C29H33N5O4 — CID 18664741
(2R,3S,4R,5R)-2-methyl-5-[4-[4-(2-morpholin-4-ylethyl)anilino]-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol (PubChem CID 18664741) has the molecular formula C29H33N5O4 and a molecular weight of 515.61 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-methyl-5-[4-[4-(2-morpholin-4-ylethyl)anilino]-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-methyl-5-[4-[4-(2-morpholin-4-ylethyl)anilino]-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 18664741 |
| Molecular Formula | C29H33N5O4 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | (2R,3S,4R,5R)-2-methyl-5-[4-[4-(2-morpholin-4-ylethyl)anilino]-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol |
| SMILES | C[C@H]1O[C@@H](n2cc(-c3ccccc3)c3c(Nc4ccc(CCN5CCOCC5)cc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H33N5O4/c1-19-25(35)26(36)29(38-19)34-17-23(21-5-3-2-4-6-21)24-27(30-18-31-28(24)34)32-22-9-7-20(8-10-22)11-12-33-13-15-37-16-14-33/h2-10,17-19,25-26,29,35-36H,11-16H2,1H3,(H,30,31,32)/t19-,25-,26-,29-/m1/s1 |
| InChIKey | GTOLTKQSQIIWJC-UOCPJPGKSA-N |
| XLogP | 3.36 |
| TPSA | 104.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |