C21H25FO3S — CID 18665151
(2S,3R,4R,5S)-5-fluoro-2-methyl-6-methylsulfanyl-3,4-bis(phenylmethoxy)oxane (PubChem CID 18665151) has the molecular formula C21H25FO3S and a molecular weight of 376.49 g/mol. Its IUPAC name is (2S,3R,4R,5S)-5-fluoro-2-methyl-6-methylsulfanyl-3,4-bis(phenylmethoxy)oxane.
| Compound Name | (2S,3R,4R,5S)-5-fluoro-2-methyl-6-methylsulfanyl-3,4-bis(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 18665151 |
| Molecular Formula | C21H25FO3S |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (2S,3R,4R,5S)-5-fluoro-2-methyl-6-methylsulfanyl-3,4-bis(phenylmethoxy)oxane |
| SMILES | CSC1O[C@@H](C)[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1F |
| InChI | InChI=1S/C21H25FO3S/c1-15-19(23-13-16-9-5-3-6-10-16)20(18(22)21(25-15)26-2)24-14-17-11-7-4-8-12-17/h3-12,15,18-21H,13-14H2,1-2H3/t15-,18-,19+,20-,21?/m0/s1 |
| InChIKey | HTQDYVONDKAPGT-QIOSGXPESA-N |
| XLogP | 4.60 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |