C25H29N7 — CID 18665175
3-[3-[(3aS,6aR)-5-(pyridin-3-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]-5-(1,2,4-triazol-4-yl)-1H-indole (PubChem CID 18665175) has the molecular formula C25H29N7 and a molecular weight of 427.56 g/mol. Its IUPAC name is 3-[3-[(3aS,6aR)-5-(pyridin-3-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]-5-(1,2,4-triazol-4-yl)-1H-indole.
| Compound Name | 3-[3-[(3aS,6aR)-5-(pyridin-3-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]-5-(1,2,4-triazol-4-yl)-1H-indole |
|---|---|
| PubChem CID | 18665175 |
| Molecular Formula | C25H29N7 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 3-[3-[(3aS,6aR)-5-(pyridin-3-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]-5-(1,2,4-triazol-4-yl)-1H-indole |
| SMILES | c1cncc(CN2C[C@H]3CN(CCCc4c[nH]c5ccc(-n6cnnc6)cc45)C[C@H]3C2)c1 |
| InChI | InChI=1S/C25H29N7/c1-3-19(10-26-7-1)12-31-15-21-13-30(14-22(21)16-31)8-2-4-20-11-27-25-6-5-23(9-24(20)25)32-17-28-29-18-32/h1,3,5-7,9-11,17-18,21-22,27H,2,4,8,12-16H2/t21-,22+ |
| InChIKey | ZERDXCGADHHPTB-SZPZYZBQSA-N |
| XLogP | 3.14 |
| TPSA | 65.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |