C23H26F3NO5S — CID 18665610
1-[(3R,5S)-7,8-dimethoxy-1,1-dioxo-5-phenyl-3-(2,2,2-trifluoroethyl)-4,5-dihydro-2H-1λ6,4-benzothiazepin-3-yl]butan-2-one (PubChem CID 18665610) has the molecular formula C23H26F3NO5S and a molecular weight of 485.52 g/mol. Its IUPAC name is 1-[(3R,5S)-7,8-dimethoxy-1,1-dioxo-5-phenyl-3-(2,2,2-trifluoroethyl)-4,5-dihydro-2H-1λ6,4-benzothiazepin-3-yl]butan-2-one.
| Compound Name | 1-[(3R,5S)-7,8-dimethoxy-1,1-dioxo-5-phenyl-3-(2,2,2-trifluoroethyl)-4,5-dihydro-2H-1λ6,4-benzothiazepin-3-yl]butan-2-one |
|---|---|
| PubChem CID | 18665610 |
| Molecular Formula | C23H26F3NO5S |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 1-[(3R,5S)-7,8-dimethoxy-1,1-dioxo-5-phenyl-3-(2,2,2-trifluoroethyl)-4,5-dihydro-2H-1λ6,4-benzothiazepin-3-yl]butan-2-one |
| SMILES | CCC(=O)C[C@@]1(CC(F)(F)F)CS(=O)(=O)c2cc(OC)c(OC)cc2[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C23H26F3NO5S/c1-4-16(28)12-22(13-23(24,25)26)14-33(29,30)20-11-19(32-3)18(31-2)10-17(20)21(27-22)15-8-6-5-7-9-15/h5-11,21,27H,4,12-14H2,1-3H3/t21-,22+/m0/s1 |
| InChIKey | QVTDJGXDTUWWAO-FCHUYYIVSA-N |
| XLogP | 4.23 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |