C38H35F6N3O2 — CID 18666339
N-(2,2,2-trifluoroethyl)-9-[4-[(3S)-3-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]pyrrolidin-1-yl]butyl]fluorene-9-carboxamide (PubChem CID 18666339) has the molecular formula C38H35F6N3O2 and a molecular weight of 679.71 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethyl)-9-[4-[(3S)-3-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]pyrrolidin-1-yl]butyl]fluorene-9-carboxamide.
| Compound Name | N-(2,2,2-trifluoroethyl)-9-[4-[(3S)-3-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]pyrrolidin-1-yl]butyl]fluorene-9-carboxamide |
|---|---|
| PubChem CID | 18666339 |
| Molecular Formula | C38H35F6N3O2 |
| Molecular Weight | 679.71 g/mol |
| Exact Mass | 679.26 |
| IUPAC Name | N-(2,2,2-trifluoroethyl)-9-[4-[(3S)-3-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]pyrrolidin-1-yl]butyl]fluorene-9-carboxamide |
| SMILES | O=C(N[C@H]1CCN(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)C1)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C38H35F6N3O2/c39-37(40,41)24-45-35(49)36(32-13-5-3-10-29(32)30-11-4-6-14-33(30)36)20-7-8-21-47-22-19-27(23-47)46-34(48)31-12-2-1-9-28(31)25-15-17-26(18-16-25)38(42,43)44/h1-6,9-18,27H,7-8,19-24H2,(H,45,49)(H,46,48)/t27-/m0/s1 |
| InChIKey | AUSAUJKQEDGSPF-MHZLTWQESA-N |
| XLogP | 7.99 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.71 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|