C17H32O3Si — CID 18666348
(1S,3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroindene-1-carboxylic acid (PubChem CID 18666348) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is (1S,3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroindene-1-carboxylic acid.
| Compound Name | (1S,3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroindene-1-carboxylic acid |
|---|---|
| PubChem CID | 18666348 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (1S,3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroindene-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC[C@]2(C)[C@@H](C(=O)O)CC[C@@H]12 |
| InChI | InChI=1S/C17H32O3Si/c1-16(2,3)21(5,6)20-14-8-7-11-17(4)12(14)9-10-13(17)15(18)19/h12-14H,7-11H2,1-6H3,(H,18,19)/t12-,13+,14-,17-/m0/s1 |
| InChIKey | MDPYOHIXWATBEX-LOUJCGABSA-N |
| XLogP | 4.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|