C22H25ClO6 — CID 18666592
(1R)-1-[(4R,4aR,8aS)-2-(4-chlorophenyl)-6-(3,4-dimethylphenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol (PubChem CID 18666592) has the molecular formula C22H25ClO6 and a molecular weight of 420.89 g/mol. Its IUPAC name is (1R)-1-[(4R,4aR,8aS)-2-(4-chlorophenyl)-6-(3,4-dimethylphenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(4R,4aR,8aS)-2-(4-chlorophenyl)-6-(3,4-dimethylphenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 18666592 |
| Molecular Formula | C22H25ClO6 |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | (1R)-1-[(4R,4aR,8aS)-2-(4-chlorophenyl)-6-(3,4-dimethylphenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol |
| SMILES | Cc1ccc(C2OC[C@@H]3OC(c4ccc(Cl)cc4)O[C@H]([C@H](O)CO)[C@@H]3O2)cc1C |
| InChI | InChI=1S/C22H25ClO6/c1-12-3-4-15(9-13(12)2)21-26-11-18-20(29-21)19(17(25)10-24)28-22(27-18)14-5-7-16(23)8-6-14/h3-9,17-22,24-25H,10-11H2,1-2H3/t17-,18+,19-,20-,21?,22?/m1/s1 |
| InChIKey | JCWBTCTXYSZAFI-RLCYQCIGSA-N |
| XLogP | 3.21 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |