C28H25Cl2NO7 — CID 18666691
(1S,2S,3S)-3-[[(2S,3R)-4-(3,4-dichlorophenyl)-3-(naphthalene-2-carbonyloxy)butan-2-yl]carbamoyl]cyclobutane-1,2-dicarboxylic acid (PubChem CID 18666691) has the molecular formula C28H25Cl2NO7 and a molecular weight of 558.41 g/mol. Its IUPAC name is (1S,2S,3S)-3-[[(2S,3R)-4-(3,4-dichlorophenyl)-3-(naphthalene-2-carbonyloxy)butan-2-yl]carbamoyl]cyclobutane-1,2-dicarboxylic acid.
| Compound Name | (1S,2S,3S)-3-[[(2S,3R)-4-(3,4-dichlorophenyl)-3-(naphthalene-2-carbonyloxy)butan-2-yl]carbamoyl]cyclobutane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 18666691 |
| Molecular Formula | C28H25Cl2NO7 |
| Molecular Weight | 558.41 g/mol |
| Exact Mass | 557.10 |
| IUPAC Name | (1S,2S,3S)-3-[[(2S,3R)-4-(3,4-dichlorophenyl)-3-(naphthalene-2-carbonyloxy)butan-2-yl]carbamoyl]cyclobutane-1,2-dicarboxylic acid |
| SMILES | C[C@H](NC(=O)[C@H]1C[C@H](C(=O)O)[C@H]1C(=O)O)[C@@H](Cc1ccc(Cl)c(Cl)c1)OC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H25Cl2NO7/c1-14(31-25(32)19-13-20(26(33)34)24(19)27(35)36)23(11-15-6-9-21(29)22(30)10-15)38-28(37)18-8-7-16-4-2-3-5-17(16)12-18/h2-10,12,14,19-20,23-24H,11,13H2,1H3,(H,31,32)(H,33,34)(H,35,36)/t14-,19-,20-,23+,24-/m0/s1 |
| InChIKey | HCFVDSISXGYLGS-DCQMZNLGSA-N |
| XLogP | 4.84 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |