C30H27Cl2NO9 — CID 18666700
trans-(1R,3R)-2-[[(2S,3R)-4-(3,4-dichlorophenyl)-3-(naphthalene-2-carbonyloxy)butan-2-yl]carbamoyl]-4-methoxycarbonylcyclobutane-1,3-dicarboxylic acid (PubChem CID 18666700) has the molecular formula C30H27Cl2NO9 and a molecular weight of 616.45 g/mol. Its IUPAC name is trans-(1R,3R)-2-[[(2S,3R)-4-(3,4-dichlorophenyl)-3-(naphthalene-2-carbonyloxy)butan-2-yl]carbamoyl]-4-methoxycarbonylcyclobutane-1,3-dicarboxylic acid.
| Compound Name | trans-(1R,3R)-2-[[(2S,3R)-4-(3,4-dichlorophenyl)-3-(naphthalene-2-carbonyloxy)butan-2-yl]carbamoyl]-4-methoxycarbonylcyclobutane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 18666700 |
| Molecular Formula | C30H27Cl2NO9 |
| Molecular Weight | 616.45 g/mol |
| Exact Mass | 615.11 |
| IUPAC Name | trans-(1R,3R)-2-[[(2S,3R)-4-(3,4-dichlorophenyl)-3-(naphthalene-2-carbonyloxy)butan-2-yl]carbamoyl]-4-methoxycarbonylcyclobutane-1,3-dicarboxylic acid |
| SMILES | COC(=O)C1[C@H](C(=O)O)C(C(=O)N[C@@H](C)[C@@H](Cc2ccc(Cl)c(Cl)c2)OC(=O)c2ccc3ccccc3c2)[C@H]1C(=O)O |
| InChI | InChI=1S/C30H27Cl2NO9/c1-14(33-26(34)22-23(27(35)36)25(30(40)41-2)24(22)28(37)38)21(12-15-7-10-19(31)20(32)11-15)42-29(39)18-9-8-16-5-3-4-6-17(16)13-18/h3-11,13-14,21-25H,12H2,1-2H3,(H,33,34)(H,35,36)(H,37,38)/t14-,21+,22?,23+,24+,25?/m0/s1 |
| InChIKey | LEBXQAREYKOYCK-NZLVPMATSA-N |
| XLogP | 4.24 |
| TPSA | 156.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |