About [(2S,3S)-6-(benzylamino)-2-methyl-1-phenylhexan-3-yl] acetate
[(2S,3S)-6-(benzylamino)-2-methyl-1-phenylhexan-3-yl] acetate (PubChem CID 18666727) has the molecular formula C22H29NO2
and a molecular weight of 339.48 g/mol. Its IUPAC name is [(2S,3S)-6-(benzylamino)-2-methyl-1-phenylhexan-3-yl] acetate.
Molecular Properties
| Compound Name | [(2S,3S)-6-(benzylamino)-2-methyl-1-phenylhexan-3-yl] acetate |
| PubChem CID | 18666727 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | [(2S,3S)-6-(benzylamino)-2-methyl-1-phenylhexan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H](CCCNCc1ccccc1)[C@@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C22H29NO2/c1-18(16-20-10-5-3-6-11-20)22(25-19(2)24)14-9-15-23-17-21-12-7-4-8-13-21/h3-8,10-13,18,22-23H,9,14-17H2,1-2H3/t18-,22-/m0/s1 |
| InChIKey | FBPDELRQHJOHDU-AVRDEDQJSA-N |
| XLogP | 4.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3S)-6-(benzylamino)-2-methyl-1-phenylhexan-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-6-(benzylamino)-2-methyl-1-phenylhexan-3-yl] acetate?
The IUPAC name of [(2S,3S)-6-(benzylamino)-2-methyl-1-phenylhexan-3-yl] acetate (CID 18666727) is [(2S,3S)-6-(benzylamino)-2-methyl-1-phenylhexan-3-yl] acetate.
What is the SMILES notation for [(2S,3S)-6-(benzylamino)-2-methyl-1-phenylhexan-3-yl] acetate?
The canonical SMILES for [(2S,3S)-6-(benzylamino)-2-methyl-1-phenylhexan-3-yl] acetate is CC(=O)O[C@@H](CCCNCc1ccccc1)[C@@H](C)Cc1ccccc1.
What is the InChIKey of [(2S,3S)-6-(benzylamino)-2-methyl-1-phenylhexan-3-yl] acetate?
The InChIKey is FBPDELRQHJOHDU-AVRDEDQJSA-N. The full InChI is InChI=1S/C22H29NO2/c1-18(16-20-10-5-3-6-11-20)22(25-19(2)24)14-9-15-23-17-21-12-7-4-8-13-21/h3-8,10-13,18,22-23H,9,14-17H2,1-2H3/t18-,22-/m0/s1.
What are the key properties of [(2S,3S)-6-(benzylamino)-2-methyl-1-phenylhexan-3-yl] acetate?
[(2S,3S)-6-(benzylamino)-2-methyl-1-phenylhexan-3-yl] acetate has a molecular weight of 339.48 g/mol, XLogP of 4.37, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-6-(benzylamino)-2-methyl-1-phenylhexan-3-yl] acetate is sourced from PubChem (CID 18666727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).